C34H38FN5O3Si — CID 162687603
2-(4-fluorophenyl)-N-[4-[7-(2-methoxyethyl)-3-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]-2-pyridinyl]acetamide (PubChem CID 162687603) has the molecular formula C34H38FN5O3Si and a molecular weight of 611.79 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[4-[7-(2-methoxyethyl)-3-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]-2-pyridinyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[4-[7-(2-methoxyethyl)-3-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 162687603 |
| Molecular Formula | C34H38FN5O3Si |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[4-[7-(2-methoxyethyl)-3-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]-2-pyridinyl]acetamide |
| SMILES | COCCc1ccnc2c(-c3ccccn3)c(-c3ccnc(NC(=O)Cc4ccc(F)cc4)c3)n(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C34H38FN5O3Si/c1-42-18-14-25-12-17-38-32-31(28-7-5-6-15-36-28)33(40(34(25)32)23-43-19-20-44(2,3)4)26-13-16-37-29(22-26)39-30(41)21-24-8-10-27(35)11-9-24/h5-13,15-17,22H,14,18-21,23H2,1-4H3,(H,37,39,41) |
| InChIKey | XCFXCMADBHZQBX-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|