C31H39N5O2Si — CID 172833087
N-[4-[7-ethenyl-3-pyridin-2-yl-1-[2-(2-triethylsilylethoxy)ethyl]pyrrolo[3,2-b]pyridin-2-yl]-2-pyridinyl]acetamide (PubChem CID 172833087) has the molecular formula C31H39N5O2Si and a molecular weight of 541.77 g/mol. Its IUPAC name is N-[4-[7-ethenyl-3-pyridin-2-yl-1-[2-(2-triethylsilylethoxy)ethyl]pyrrolo[3,2-b]pyridin-2-yl]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[7-ethenyl-3-pyridin-2-yl-1-[2-(2-triethylsilylethoxy)ethyl]pyrrolo[3,2-b]pyridin-2-yl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 172833087 |
| Molecular Formula | C31H39N5O2Si |
| Molecular Weight | 541.77 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | N-[4-[7-ethenyl-3-pyridin-2-yl-1-[2-(2-triethylsilylethoxy)ethyl]pyrrolo[3,2-b]pyridin-2-yl]-2-pyridinyl]acetamide |
| SMILES | C=Cc1ccnc2c(-c3ccccn3)c(-c3ccnc(NC(C)=O)c3)n(CCOCC[Si](CC)(CC)CC)c12 |
| InChI | InChI=1S/C31H39N5O2Si/c1-6-24-13-17-34-29-28(26-12-10-11-15-32-26)30(25-14-16-33-27(22-25)35-23(5)37)36(31(24)29)18-19-38-20-21-39(7-2,8-3)9-4/h6,10-17,22H,1,7-9,18-21H2,2-5H3,(H,33,35,37) |
| InChIKey | VTUPCNACNHTHFI-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.77 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|