C19H21FN4OS — CID 24810307
4-[5-(4-fluorophenyl)-3-methyl-2-methylsulfanylimidazol-4-yl]-N-(2-methoxyethyl)pyridin-2-amine (PubChem CID 24810307) has the molecular formula C19H21FN4OS and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-3-methyl-2-methylsulfanylimidazol-4-yl]-N-(2-methoxyethyl)pyridin-2-amine.
| Compound Name | 4-[5-(4-fluorophenyl)-3-methyl-2-methylsulfanylimidazol-4-yl]-N-(2-methoxyethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 24810307 |
| Molecular Formula | C19H21FN4OS |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-3-methyl-2-methylsulfanylimidazol-4-yl]-N-(2-methoxyethyl)pyridin-2-amine |
| SMILES | COCCNc1cc(-c2c(-c3ccc(F)cc3)nc(SC)n2C)ccn1 |
| InChI | InChI=1S/C19H21FN4OS/c1-24-18(14-8-9-21-16(12-14)22-10-11-25-2)17(23-19(24)26-3)13-4-6-15(20)7-5-13/h4-9,12H,10-11H2,1-3H3,(H,21,22) |
| InChIKey | VVUQUDHAUXHAKF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|