C22H25FN4OS — CID 11502486
N-cyclohexyl-4-[5-(4-fluorophenyl)-3-methyl-2-methylsulfinylimidazol-4-yl]pyridin-2-amine (PubChem CID 11502486) has the molecular formula C22H25FN4OS and a molecular weight of 412.53 g/mol. Its IUPAC name is N-cyclohexyl-4-[5-(4-fluorophenyl)-3-methyl-2-methylsulfinylimidazol-4-yl]pyridin-2-amine.
| Compound Name | N-cyclohexyl-4-[5-(4-fluorophenyl)-3-methyl-2-methylsulfinylimidazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 11502486 |
| Molecular Formula | C22H25FN4OS |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-cyclohexyl-4-[5-(4-fluorophenyl)-3-methyl-2-methylsulfinylimidazol-4-yl]pyridin-2-amine |
| SMILES | Cn1c(S(C)=O)nc(-c2ccc(F)cc2)c1-c1ccnc(NC2CCCCC2)c1 |
| InChI | InChI=1S/C22H25FN4OS/c1-27-21(16-12-13-24-19(14-16)25-18-6-4-3-5-7-18)20(26-22(27)29(2)28)15-8-10-17(23)11-9-15/h8-14,18H,3-7H2,1-2H3,(H,24,25) |
| InChIKey | ZJKMYKOLRJLJBO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |