C18H16FN5O3S — CID 87695253
4-[4-(4-fluorophenyl)-2-(4-sulfonyloxan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-amine (PubChem CID 87695253) has the molecular formula C18H16FN5O3S and a molecular weight of 401.42 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)-2-(4-sulfonyloxan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-amine.
| Compound Name | 4-[4-(4-fluorophenyl)-2-(4-sulfonyloxan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 87695253 |
| Molecular Formula | C18H16FN5O3S |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 4-[4-(4-fluorophenyl)-2-(4-sulfonyloxan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2[nH]c(C3CC(=S(=O)=O)CCO3)nc2-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H16FN5O3S/c19-11-3-1-10(2-4-11)15-16(13-5-7-21-18(20)22-13)24-17(23-15)14-9-12(28(25)26)6-8-27-14/h1-5,7,14H,6,8-9H2,(H,23,24)(H2,20,21,22) |
| InChIKey | IJZOAABRZRPIQQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|