C21H24FN5O4 — CID 22254934
2-[4-(4-fluorophenyl)-5-[2-(2-methoxyethoxy)pyrimidin-4-yl]-1H-imidazol-2-yl]-5-methyl-1,3-dioxan-5-amine (PubChem CID 22254934) has the molecular formula C21H24FN5O4 and a molecular weight of 429.45 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-5-[2-(2-methoxyethoxy)pyrimidin-4-yl]-1H-imidazol-2-yl]-5-methyl-1,3-dioxan-5-amine.
| Compound Name | 2-[4-(4-fluorophenyl)-5-[2-(2-methoxyethoxy)pyrimidin-4-yl]-1H-imidazol-2-yl]-5-methyl-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 22254934 |
| Molecular Formula | C21H24FN5O4 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-5-[2-(2-methoxyethoxy)pyrimidin-4-yl]-1H-imidazol-2-yl]-5-methyl-1,3-dioxan-5-amine |
| SMILES | COCCOc1nccc(-c2[nH]c(C3OCC(C)(N)CO3)nc2-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H24FN5O4/c1-21(23)11-30-19(31-12-21)18-26-16(13-3-5-14(22)6-4-13)17(27-18)15-7-8-24-20(25-15)29-10-9-28-2/h3-8,19H,9-12,23H2,1-2H3,(H,26,27) |
| InChIKey | UNDBBMOZRMTYDZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 117.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|