C25H28FN7O4 — CID 54393279
N-(cyanomethyl)-2-[4-(4-fluorophenyl)-5-[2-(3-methoxypropylamino)pyrimidin-4-yl]-1H-imidazol-2-yl]-5-methyl-1,3-dioxane-5-carboxamide (PubChem CID 54393279) has the molecular formula C25H28FN7O4 and a molecular weight of 509.54 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[4-(4-fluorophenyl)-5-[2-(3-methoxypropylamino)pyrimidin-4-yl]-1H-imidazol-2-yl]-5-methyl-1,3-dioxane-5-carboxamide.
| Compound Name | N-(cyanomethyl)-2-[4-(4-fluorophenyl)-5-[2-(3-methoxypropylamino)pyrimidin-4-yl]-1H-imidazol-2-yl]-5-methyl-1,3-dioxane-5-carboxamide |
|---|---|
| PubChem CID | 54393279 |
| Molecular Formula | C25H28FN7O4 |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | N-(cyanomethyl)-2-[4-(4-fluorophenyl)-5-[2-(3-methoxypropylamino)pyrimidin-4-yl]-1H-imidazol-2-yl]-5-methyl-1,3-dioxane-5-carboxamide |
| SMILES | COCCCNc1nccc(-c2[nH]c(C3OCC(C)(C(=O)NCC#N)CO3)nc2-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C25H28FN7O4/c1-25(23(34)28-12-9-27)14-36-22(37-15-25)21-32-19(16-4-6-17(26)7-5-16)20(33-21)18-8-11-30-24(31-18)29-10-3-13-35-2/h4-8,11,22H,3,10,12-15H2,1-2H3,(H,28,34)(H,32,33)(H,29,30,31) |
| InChIKey | VIECOVQETNIWOO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|