C26H31FN6O4 — CID 54017954
2-[4-(4-fluorophenyl)-5-[2-(prop-2-enylamino)pyrimidin-4-yl]-1H-imidazol-2-yl]-N-(3-methoxypropyl)-5-methyl-1,3-dioxane-5-carboxamide (PubChem CID 54017954) has the molecular formula C26H31FN6O4 and a molecular weight of 510.57 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-5-[2-(prop-2-enylamino)pyrimidin-4-yl]-1H-imidazol-2-yl]-N-(3-methoxypropyl)-5-methyl-1,3-dioxane-5-carboxamide.
| Compound Name | 2-[4-(4-fluorophenyl)-5-[2-(prop-2-enylamino)pyrimidin-4-yl]-1H-imidazol-2-yl]-N-(3-methoxypropyl)-5-methyl-1,3-dioxane-5-carboxamide |
|---|---|
| PubChem CID | 54017954 |
| Molecular Formula | C26H31FN6O4 |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-5-[2-(prop-2-enylamino)pyrimidin-4-yl]-1H-imidazol-2-yl]-N-(3-methoxypropyl)-5-methyl-1,3-dioxane-5-carboxamide |
| SMILES | C=CCNc1nccc(-c2[nH]c(C3OCC(C)(C(=O)NCCCOC)CO3)nc2-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C26H31FN6O4/c1-4-11-29-25-30-13-10-19(31-25)21-20(17-6-8-18(27)9-7-17)32-22(33-21)23-36-15-26(2,16-37-23)24(34)28-12-5-14-35-3/h4,6-10,13,23H,1,5,11-12,14-16H2,2-3H3,(H,28,34)(H,32,33)(H,29,30,31) |
| InChIKey | KWXAYEDESSNHEC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 123.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|