C21H20FN7O3 — CID 174568921
2-[5-[2-[cyano(methyl)amino]pyrimidin-4-yl]-4-(4-fluorophenyl)-1H-imidazol-2-yl]-5-methyl-1,3-dioxane-5-carboxamide (PubChem CID 174568921) has the molecular formula C21H20FN7O3 and a molecular weight of 437.44 g/mol. Its IUPAC name is 2-[5-[2-[cyano(methyl)amino]pyrimidin-4-yl]-4-(4-fluorophenyl)-1H-imidazol-2-yl]-5-methyl-1,3-dioxane-5-carboxamide.
| Compound Name | 2-[5-[2-[cyano(methyl)amino]pyrimidin-4-yl]-4-(4-fluorophenyl)-1H-imidazol-2-yl]-5-methyl-1,3-dioxane-5-carboxamide |
|---|---|
| PubChem CID | 174568921 |
| Molecular Formula | C21H20FN7O3 |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-[5-[2-[cyano(methyl)amino]pyrimidin-4-yl]-4-(4-fluorophenyl)-1H-imidazol-2-yl]-5-methyl-1,3-dioxane-5-carboxamide |
| SMILES | CN(C#N)c1nccc(-c2[nH]c(C3OCC(C)(C(N)=O)CO3)nc2-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H20FN7O3/c1-21(19(24)30)9-31-18(32-10-21)17-27-15(12-3-5-13(22)6-4-12)16(28-17)14-7-8-25-20(26-14)29(2)11-23/h3-8,18H,9-10H2,1-2H3,(H2,24,30)(H,27,28) |
| InChIKey | FAQLDKWEDQITJY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 143.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|