C12H19N3O2S — CID 174579494
tert-butyl 4-(5-amino-1,2-thiazol-3-yl)-2-iminopentanoate (PubChem CID 174579494) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is tert-butyl 4-(5-amino-1,2-thiazol-3-yl)-2-iminopentanoate.
| Compound Name | tert-butyl 4-(5-amino-1,2-thiazol-3-yl)-2-iminopentanoate |
|---|---|
| PubChem CID | 174579494 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | tert-butyl 4-(5-amino-1,2-thiazol-3-yl)-2-iminopentanoate |
| SMILES | [H]/N=C(/CC(C)c1cc(N)sn1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H19N3O2S/c1-7(9-6-10(14)18-15-9)5-8(13)11(16)17-12(2,3)4/h6-7,13H,5,14H2,1-4H3/b13-8- |
| InChIKey | UVWURAOGRFFZEA-JYRVWZFOSA-N |
| XLogP | 2.58 |
| TPSA | 89.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|