C16H14O — CID 10889496
1,2-diphenylbuta-2,3-dien-1-ol (PubChem CID 10889496) has the molecular formula C16H14O and a molecular weight of 222.29 g/mol. Its IUPAC name is 1,2-diphenylbuta-2,3-dien-1-ol.
| Compound Name | 1,2-diphenylbuta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 10889496 |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 1,2-diphenylbuta-2,3-dien-1-ol |
| SMILES | C=C=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C16H14O/c1-2-15(13-9-5-3-6-10-13)16(17)14-11-7-4-8-12-14/h3-12,16-17H,1H2 |
| InChIKey | FBQIGKQHODEQQG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |