C13H16O — CID 174694094
4-methoxyhexa-1,2-dien-3-ylbenzene (PubChem CID 174694094) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 4-methoxyhexa-1,2-dien-3-ylbenzene.
| Compound Name | 4-methoxyhexa-1,2-dien-3-ylbenzene |
|---|---|
| PubChem CID | 174694094 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 4-methoxyhexa-1,2-dien-3-ylbenzene |
| SMILES | C=C=C(c1ccccc1)C(CC)OC |
| InChI | InChI=1S/C13H16O/c1-4-12(13(5-2)14-3)11-9-7-6-8-10-11/h6-10,13H,1,5H2,2-3H3 |
| InChIKey | CZLFUEVOJBFEIH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |