C11H9Cl3O — CID 134993712
1,1,1-trichloro-3-phenylpenta-3,4-dien-2-ol (PubChem CID 134993712) has the molecular formula C11H9Cl3O and a molecular weight of 263.55 g/mol. Its IUPAC name is 1,1,1-trichloro-3-phenylpenta-3,4-dien-2-ol.
| Compound Name | 1,1,1-trichloro-3-phenylpenta-3,4-dien-2-ol |
|---|---|
| PubChem CID | 134993712 |
| Molecular Formula | C11H9Cl3O |
| Molecular Weight | 263.55 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 1,1,1-trichloro-3-phenylpenta-3,4-dien-2-ol |
| SMILES | C=C=C(c1ccccc1)C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H9Cl3O/c1-2-9(10(15)11(12,13)14)8-6-4-3-5-7-8/h3-7,10,15H,1H2 |
| InChIKey | MTTIHSHUEVTJSS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|