C20H32NO3P — CID 10893868
1-di(propan-2-yloxy)phosphoryl-N,N-diethyl-2-phenylbuta-2,3-dien-1-amine (PubChem CID 10893868) has the molecular formula C20H32NO3P and a molecular weight of 365.45 g/mol. Its IUPAC name is 1-di(propan-2-yloxy)phosphoryl-N,N-diethyl-2-phenylbuta-2,3-dien-1-amine.
| Compound Name | 1-di(propan-2-yloxy)phosphoryl-N,N-diethyl-2-phenylbuta-2,3-dien-1-amine |
|---|---|
| PubChem CID | 10893868 |
| Molecular Formula | C20H32NO3P |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-di(propan-2-yloxy)phosphoryl-N,N-diethyl-2-phenylbuta-2,3-dien-1-amine |
| SMILES | C=C=C(c1ccccc1)C(N(CC)CC)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C20H32NO3P/c1-8-19(18-14-12-11-13-15-18)20(21(9-2)10-3)25(22,23-16(4)5)24-17(6)7/h11-17,20H,1,9-10H2,2-7H3 |
| InChIKey | ZEWZHHHHTWAVCI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|