C26H29O3P — CID 102258998
[2-di(propan-2-yloxy)phosphoryl-1,2-diphenylethenyl]benzene (PubChem CID 102258998) has the molecular formula C26H29O3P and a molecular weight of 420.49 g/mol. Its IUPAC name is [2-di(propan-2-yloxy)phosphoryl-1,2-diphenylethenyl]benzene.
| Compound Name | [2-di(propan-2-yloxy)phosphoryl-1,2-diphenylethenyl]benzene |
|---|---|
| PubChem CID | 102258998 |
| Molecular Formula | C26H29O3P |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | [2-di(propan-2-yloxy)phosphoryl-1,2-diphenylethenyl]benzene |
| SMILES | CC(C)OP(=O)(OC(C)C)C(=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29O3P/c1-20(2)28-30(27,29-21(3)4)26(24-18-12-7-13-19-24)25(22-14-8-5-9-15-22)23-16-10-6-11-17-23/h5-21H,1-4H3 |
| InChIKey | LOYDFMIIXXGHCQ-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|