C28H33PS — CID 22623381
ditert-butyl-sulfanylidene-(1,2,2-triphenylethenyl)-λ5-phosphane (PubChem CID 22623381) has the molecular formula C28H33PS and a molecular weight of 432.61 g/mol. Its IUPAC name is ditert-butyl-sulfanylidene-(1,2,2-triphenylethenyl)-λ5-phosphane.
| Compound Name | ditert-butyl-sulfanylidene-(1,2,2-triphenylethenyl)-λ5-phosphane |
|---|---|
| PubChem CID | 22623381 |
| Molecular Formula | C28H33PS |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | ditert-butyl-sulfanylidene-(1,2,2-triphenylethenyl)-λ5-phosphane |
| SMILES | CC(C)(C)P(=S)(C(=C(c1ccccc1)c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H33PS/c1-27(2,3)29(30,28(4,5)6)26(24-20-14-9-15-21-24)25(22-16-10-7-11-17-22)23-18-12-8-13-19-23/h7-21H,1-6H3 |
| InChIKey | NXZIWZDLMGGUTN-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|