C34H52O2 — CID 102409217
5-benzhydrylidene-3,7-ditert-butyl-2,2,8,8-tetramethylnonane-3,7-diol (PubChem CID 102409217) has the molecular formula C34H52O2 and a molecular weight of 492.79 g/mol. Its IUPAC name is 5-benzhydrylidene-3,7-ditert-butyl-2,2,8,8-tetramethylnonane-3,7-diol.
| Compound Name | 5-benzhydrylidene-3,7-ditert-butyl-2,2,8,8-tetramethylnonane-3,7-diol |
|---|---|
| PubChem CID | 102409217 |
| Molecular Formula | C34H52O2 |
| Molecular Weight | 492.79 g/mol |
| Exact Mass | 492.40 |
| IUPAC Name | 5-benzhydrylidene-3,7-ditert-butyl-2,2,8,8-tetramethylnonane-3,7-diol |
| SMILES | CC(C)(C)C(O)(CC(CC(O)(C(C)(C)C)C(C)(C)C)=C(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H52O2/c1-29(2,3)33(35,30(4,5)6)23-27(24-34(36,31(7,8)9)32(10,11)12)28(25-19-15-13-16-20-25)26-21-17-14-18-22-26/h13-22,35-36H,23-24H2,1-12H3 |
| InChIKey | JLHHLNHATVCSSN-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.79 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |