C26H31OP — CID 15423949
[(2-ditert-butylphosphorylcyclopenta-2,4-dien-1-ylidene)-phenylmethyl]benzene (PubChem CID 15423949) has the molecular formula C26H31OP and a molecular weight of 390.51 g/mol. Its IUPAC name is [(2-ditert-butylphosphorylcyclopenta-2,4-dien-1-ylidene)-phenylmethyl]benzene.
| Compound Name | [(2-ditert-butylphosphorylcyclopenta-2,4-dien-1-ylidene)-phenylmethyl]benzene |
|---|---|
| PubChem CID | 15423949 |
| Molecular Formula | C26H31OP |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | [(2-ditert-butylphosphorylcyclopenta-2,4-dien-1-ylidene)-phenylmethyl]benzene |
| SMILES | CC(C)(C)P(=O)(C1=CC=CC1=C(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H31OP/c1-25(2,3)28(27,26(4,5)6)23-19-13-18-22(23)24(20-14-9-7-10-15-20)21-16-11-8-12-17-21/h7-19H,1-6H3 |
| InChIKey | YMFPCHMPZBYMQV-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|