About [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid
[(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid (PubChem CID 152733650) has the molecular formula C12H17O4P
and a molecular weight of 256.24 g/mol. Its IUPAC name is [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid.
Molecular Properties
| Compound Name | [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid |
| PubChem CID | 152733650 |
| Molecular Formula | C12H17O4P |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid |
| SMILES | C/C(=C(/C)[C@@](C)(O)P(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C12H17O4P/c1-9(11-7-5-4-6-8-11)10(2)12(3,13)17(14,15)16/h4-8,13H,1-3H3,(H2,14,15,16)/b10-9+/t12-/m0/s1 |
| InChIKey | ZYDJPEZYYBEOHX-VMPCVLLUSA-N |
| XLogP | 2.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid?
The IUPAC name of [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid (CID 152733650) is [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid.
What is the SMILES notation for [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid?
The canonical SMILES for [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid is C/C(=C(/C)[C@@](C)(O)P(=O)(O)O)c1ccccc1.
What is the InChIKey of [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid?
The InChIKey is ZYDJPEZYYBEOHX-VMPCVLLUSA-N. The full InChI is InChI=1S/C12H17O4P/c1-9(11-7-5-4-6-8-11)10(2)12(3,13)17(14,15)16/h4-8,13H,1-3H3,(H2,14,15,16)/b10-9+/t12-/m0/s1.
What are the key properties of [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid?
[(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid has a molecular weight of 256.24 g/mol, XLogP of 2.37, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid is sourced from PubChem (CID 152733650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).