C12H17O4P — CID 152733650
[(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid (PubChem CID 152733650) has the molecular formula C12H17O4P and a molecular weight of 256.24 g/mol. Its IUPAC name is [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid.
| Compound Name | [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 152733650 |
| Molecular Formula | C12H17O4P |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | [(E,2S)-2-hydroxy-3-methyl-4-phenylpent-3-en-2-yl]phosphonic acid |
| SMILES | C/C(=C(/C)[C@@](C)(O)P(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C12H17O4P/c1-9(11-7-5-4-6-8-11)10(2)12(3,13)17(14,15)16/h4-8,13H,1-3H3,(H2,14,15,16)/b10-9+/t12-/m0/s1 |
| InChIKey | ZYDJPEZYYBEOHX-VMPCVLLUSA-N |
| XLogP | 2.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|