About 1-phenylpropa-1,2-dienyl propanoate
1-phenylpropa-1,2-dienyl propanoate (PubChem CID 174457203) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 1-phenylpropa-1,2-dienyl propanoate.
Molecular Properties
| Compound Name | 1-phenylpropa-1,2-dienyl propanoate |
| PubChem CID | 174457203 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 1-phenylpropa-1,2-dienyl propanoate |
| SMILES | C=C=C(OC(=O)CC)c1ccccc1 |
| InChI | InChI=1S/C12H12O2/c1-3-11(14-12(13)4-2)10-8-6-5-7-9-10/h5-9H,1,4H2,2H3 |
| InChIKey | DQVFKHSMXWQCHK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylpropa-1,2-dienyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropa-1,2-dienyl propanoate?
The IUPAC name of 1-phenylpropa-1,2-dienyl propanoate (CID 174457203) is 1-phenylpropa-1,2-dienyl propanoate.
What is the SMILES notation for 1-phenylpropa-1,2-dienyl propanoate?
The canonical SMILES for 1-phenylpropa-1,2-dienyl propanoate is C=C=C(OC(=O)CC)c1ccccc1.
What is the InChIKey of 1-phenylpropa-1,2-dienyl propanoate?
The InChIKey is DQVFKHSMXWQCHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c1-3-11(14-12(13)4-2)10-8-6-5-7-9-10/h5-9H,1,4H2,2H3.
What are the key properties of 1-phenylpropa-1,2-dienyl propanoate?
1-phenylpropa-1,2-dienyl propanoate has a molecular weight of 188.23 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropa-1,2-dienyl propanoate is sourced from PubChem (CID 174457203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).