C13H14 — CID 142698544
3-ethylpenta-1,3,4-trien-2-ylbenzene (PubChem CID 142698544) has the molecular formula C13H14 and a molecular weight of 170.25 g/mol. Its IUPAC name is 3-ethylpenta-1,3,4-trien-2-ylbenzene.
| Compound Name | 3-ethylpenta-1,3,4-trien-2-ylbenzene |
|---|---|
| PubChem CID | 142698544 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-ethylpenta-1,3,4-trien-2-ylbenzene |
| SMILES | C=C=C(CC)C(=C)c1ccccc1 |
| InChI | InChI=1S/C13H14/c1-4-12(5-2)11(3)13-9-7-6-8-10-13/h6-10H,1,3,5H2,2H3 |
| InChIKey | QDKMOCMSTMNLHC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|