About [(3E)-octa-1,3-dien-2-yl]sulfinylbenzene
[(3E)-octa-1,3-dien-2-yl]sulfinylbenzene (PubChem CID 46928436) has the molecular formula C14H18OS
and a molecular weight of 234.36 g/mol. Its IUPAC name is [(3E)-octa-1,3-dien-2-yl]sulfinylbenzene.
Molecular Properties
| Compound Name | [(3E)-octa-1,3-dien-2-yl]sulfinylbenzene |
| PubChem CID | 46928436 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | [(3E)-octa-1,3-dien-2-yl]sulfinylbenzene |
| SMILES | C=C(/C=C/CCCC)S(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18OS/c1-3-4-5-7-10-13(2)16(15)14-11-8-6-9-12-14/h6-12H,2-5H2,1H3/b10-7+ |
| InChIKey | OARSJSXOVORAGA-JXMROGBWSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-octa-1,3-dien-2-yl]sulfinylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-octa-1,3-dien-2-yl]sulfinylbenzene?
The IUPAC name of [(3E)-octa-1,3-dien-2-yl]sulfinylbenzene (CID 46928436) is [(3E)-octa-1,3-dien-2-yl]sulfinylbenzene.
What is the SMILES notation for [(3E)-octa-1,3-dien-2-yl]sulfinylbenzene?
The canonical SMILES for [(3E)-octa-1,3-dien-2-yl]sulfinylbenzene is C=C(/C=C/CCCC)S(=O)c1ccccc1.
What is the InChIKey of [(3E)-octa-1,3-dien-2-yl]sulfinylbenzene?
The InChIKey is OARSJSXOVORAGA-JXMROGBWSA-N. The full InChI is InChI=1S/C14H18OS/c1-3-4-5-7-10-13(2)16(15)14-11-8-6-9-12-14/h6-12H,2-5H2,1H3/b10-7+.
What are the key properties of [(3E)-octa-1,3-dien-2-yl]sulfinylbenzene?
[(3E)-octa-1,3-dien-2-yl]sulfinylbenzene has a molecular weight of 234.36 g/mol, XLogP of 4.05, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-octa-1,3-dien-2-yl]sulfinylbenzene is sourced from PubChem (CID 46928436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).