C17H22 — CID 101219180
[(4E,6E)-undeca-1,4,6-trien-5-yl]benzene (PubChem CID 101219180) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is [(4E,6E)-undeca-1,4,6-trien-5-yl]benzene.
| Compound Name | [(4E,6E)-undeca-1,4,6-trien-5-yl]benzene |
|---|---|
| PubChem CID | 101219180 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | [(4E,6E)-undeca-1,4,6-trien-5-yl]benzene |
| SMILES | C=CC/C=C(\C=C\CCCC)c1ccccc1 |
| InChI | InChI=1S/C17H22/c1-3-5-7-9-13-16(12-6-4-2)17-14-10-8-11-15-17/h4,8-15H,2-3,5-7H2,1H3/b13-9+,16-12+ |
| InChIKey | ZZSZUXJXAIUPMD-PWIIIKTLSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|