C9H16O2S — CID 16681245
(4Z)-6-ethylsulfinylhepta-4,6-dien-1-ol (PubChem CID 16681245) has the molecular formula C9H16O2S and a molecular weight of 188.29 g/mol. Its IUPAC name is (4Z)-6-ethylsulfinylhepta-4,6-dien-1-ol.
| Compound Name | (4Z)-6-ethylsulfinylhepta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 16681245 |
| Molecular Formula | C9H16O2S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (4Z)-6-ethylsulfinylhepta-4,6-dien-1-ol |
| SMILES | C=C(/C=C\CCCO)S(=O)CC |
| InChI | InChI=1S/C9H16O2S/c1-3-12(11)9(2)7-5-4-6-8-10/h5,7,10H,2-4,6,8H2,1H3/b7-5- |
| InChIKey | WBTDFTHDHHCHDG-ALCCZGGFSA-N |
| XLogP | 1.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|