C16H24OSi — CID 102299018
dimethyl-[(3E)-octa-1,3-dien-2-yl]oxy-phenylsilane (PubChem CID 102299018) has the molecular formula C16H24OSi and a molecular weight of 260.45 g/mol. Its IUPAC name is dimethyl-[(3E)-octa-1,3-dien-2-yl]oxy-phenylsilane.
| Compound Name | dimethyl-[(3E)-octa-1,3-dien-2-yl]oxy-phenylsilane |
|---|---|
| PubChem CID | 102299018 |
| Molecular Formula | C16H24OSi |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | dimethyl-[(3E)-octa-1,3-dien-2-yl]oxy-phenylsilane |
| SMILES | C=C(/C=C/CCCC)O[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H24OSi/c1-5-6-7-9-12-15(2)17-18(3,4)16-13-10-8-11-14-16/h8-14H,2,5-7H2,1,3-4H3/b12-9+ |
| InChIKey | FEPQGDORLPVQOX-FMIVXFBMSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|