C28H30OSi — CID 135078042
(2E,5Z)-1-triphenylsilyldeca-2,5-dien-1-one (PubChem CID 135078042) has the molecular formula C28H30OSi and a molecular weight of 410.63 g/mol. Its IUPAC name is (2E,5Z)-1-triphenylsilyldeca-2,5-dien-1-one.
| Compound Name | (2E,5Z)-1-triphenylsilyldeca-2,5-dien-1-one |
|---|---|
| PubChem CID | 135078042 |
| Molecular Formula | C28H30OSi |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (2E,5Z)-1-triphenylsilyldeca-2,5-dien-1-one |
| SMILES | CCCC/C=C\C/C=C/C(=O)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30OSi/c1-2-3-4-5-6-7-17-24-28(29)30(25-18-11-8-12-19-25,26-20-13-9-14-21-26)27-22-15-10-16-23-27/h5-6,8-24H,2-4,7H2,1H3/b6-5-,24-17+ |
| InChIKey | XPHTWAUNVLCQJB-AJWRTPOKSA-N |
| XLogP | 4.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|