About tert-butylbenzene;diphenylphosphorylformaldehyde
tert-butylbenzene;diphenylphosphorylformaldehyde (PubChem CID 174403578) has the molecular formula C23H25O2P
and a molecular weight of 364.43 g/mol. Its IUPAC name is tert-butylbenzene;diphenylphosphorylformaldehyde.
Molecular Properties
| Compound Name | tert-butylbenzene;diphenylphosphorylformaldehyde |
| PubChem CID | 174403578 |
| Molecular Formula | C23H25O2P |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | tert-butylbenzene;diphenylphosphorylformaldehyde |
| SMILES | CC(C)(C)c1ccccc1.O=CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H11O2P.C10H14/c14-11-16(15,12-7-3-1-4-8-12)13-9-5-2-6-10-13;1-10(2,3)9-7-5-4-6-8-9/h1-11H;4-8H,1-3H3 |
| InChIKey | AGEGSHUZDFIMAR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butylbenzene;diphenylphosphorylformaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylbenzene;diphenylphosphorylformaldehyde?
The IUPAC name of tert-butylbenzene;diphenylphosphorylformaldehyde (CID 174403578) is tert-butylbenzene;diphenylphosphorylformaldehyde.
What is the SMILES notation for tert-butylbenzene;diphenylphosphorylformaldehyde?
The canonical SMILES for tert-butylbenzene;diphenylphosphorylformaldehyde is CC(C)(C)c1ccccc1.O=CP(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butylbenzene;diphenylphosphorylformaldehyde?
The InChIKey is AGEGSHUZDFIMAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11O2P.C10H14/c14-11-16(15,12-7-3-1-4-8-12)13-9-5-2-6-10-13;1-10(2,3)9-7-5-4-6-8-9/h1-11H;4-8H,1-3H3.
What are the key properties of tert-butylbenzene;diphenylphosphorylformaldehyde?
tert-butylbenzene;diphenylphosphorylformaldehyde has a molecular weight of 364.43 g/mol, XLogP of 5.17, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylbenzene;diphenylphosphorylformaldehyde is sourced from PubChem (CID 174403578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).