C18H16BrOP — CID 71536318
[[(1E)-2-bromo-3-methylidenepenta-1,4-dienyl]-phenylphosphoryl]benzene (PubChem CID 71536318) has the molecular formula C18H16BrOP and a molecular weight of 359.20 g/mol. Its IUPAC name is [[(1E)-2-bromo-3-methylidenepenta-1,4-dienyl]-phenylphosphoryl]benzene.
| Compound Name | [[(1E)-2-bromo-3-methylidenepenta-1,4-dienyl]-phenylphosphoryl]benzene |
|---|---|
| PubChem CID | 71536318 |
| Molecular Formula | C18H16BrOP |
| Molecular Weight | 359.20 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | [[(1E)-2-bromo-3-methylidenepenta-1,4-dienyl]-phenylphosphoryl]benzene |
| SMILES | C=CC(=C)/C(Br)=C\P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16BrOP/c1-3-15(2)18(19)14-21(20,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h3-14H,1-2H2/b18-14+ |
| InChIKey | HJAHSICRIIHPME-NBVRZTHBSA-N |
| XLogP | 4.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.20 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|