C15H12O2 — CID 15324204
2,2-diphenylpropanedial (PubChem CID 15324204) has the molecular formula C15H12O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2,2-diphenylpropanedial.
| Compound Name | 2,2-diphenylpropanedial |
|---|---|
| PubChem CID | 15324204 |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2,2-diphenylpropanedial |
| SMILES | O=CC(C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12O2/c16-11-15(12-17,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H |
| InChIKey | KRJZGRGAJPZPPW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|