C15H11F3OS — CID 162540000
2,2-diphenyl-2-(trifluoromethylsulfanyl)acetaldehyde (PubChem CID 162540000) has the molecular formula C15H11F3OS and a molecular weight of 296.31 g/mol. Its IUPAC name is 2,2-diphenyl-2-(trifluoromethylsulfanyl)acetaldehyde.
| Compound Name | 2,2-diphenyl-2-(trifluoromethylsulfanyl)acetaldehyde |
|---|---|
| PubChem CID | 162540000 |
| Molecular Formula | C15H11F3OS |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2,2-diphenyl-2-(trifluoromethylsulfanyl)acetaldehyde |
| SMILES | O=CC(SC(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H11F3OS/c16-15(17,18)20-14(11-19,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11H |
| InChIKey | VIABPZXXYOZACV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|