C20H24O — CID 173351548
2-(2,3,4,5,6-pentamethylphenyl)-2-phenylpropanal (PubChem CID 173351548) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentamethylphenyl)-2-phenylpropanal.
| Compound Name | 2-(2,3,4,5,6-pentamethylphenyl)-2-phenylpropanal |
|---|---|
| PubChem CID | 173351548 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-(2,3,4,5,6-pentamethylphenyl)-2-phenylpropanal |
| SMILES | Cc1c(C)c(C)c(C(C)(C=O)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C20H24O/c1-13-14(2)16(4)19(17(5)15(13)3)20(6,12-21)18-10-8-7-9-11-18/h7-12H,1-6H3 |
| InChIKey | CMQQCFJZJBBVFQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|