C22H20O3 — CID 88601459
2,2-bis(3-hydroxy-2-methylphenyl)-2-phenylacetaldehyde (PubChem CID 88601459) has the molecular formula C22H20O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2,2-bis(3-hydroxy-2-methylphenyl)-2-phenylacetaldehyde.
| Compound Name | 2,2-bis(3-hydroxy-2-methylphenyl)-2-phenylacetaldehyde |
|---|---|
| PubChem CID | 88601459 |
| Molecular Formula | C22H20O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2,2-bis(3-hydroxy-2-methylphenyl)-2-phenylacetaldehyde |
| SMILES | Cc1c(O)cccc1C(C=O)(c1ccccc1)c1cccc(O)c1C |
| InChI | InChI=1S/C22H20O3/c1-15-18(10-6-12-20(15)24)22(14-23,17-8-4-3-5-9-17)19-11-7-13-21(25)16(19)2/h3-14,24-25H,1-2H3 |
| InChIKey | VLAGQLHDKQJGHJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|