About 2-methylbenzene-1,3-diol;phenol
2-methylbenzene-1,3-diol;phenol (PubChem CID 161016987) has the molecular formula C19H20O4
and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-methylbenzene-1,3-diol;phenol.
Molecular Properties
| Compound Name | 2-methylbenzene-1,3-diol;phenol |
| PubChem CID | 161016987 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-methylbenzene-1,3-diol;phenol |
| SMILES | Cc1c(O)cccc1O.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C7H8O2.2C6H6O/c1-5-6(8)3-2-4-7(5)9;2*7-6-4-2-1-3-5-6/h2-4,8-9H,1H3;2*1-5,7H |
| InChIKey | TXVXODDVNXVLFG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylbenzene-1,3-diol;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzene-1,3-diol;phenol?
The IUPAC name of 2-methylbenzene-1,3-diol;phenol (CID 161016987) is 2-methylbenzene-1,3-diol;phenol.
What is the SMILES notation for 2-methylbenzene-1,3-diol;phenol?
The canonical SMILES for 2-methylbenzene-1,3-diol;phenol is Cc1c(O)cccc1O.Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of 2-methylbenzene-1,3-diol;phenol?
The InChIKey is TXVXODDVNXVLFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.2C6H6O/c1-5-6(8)3-2-4-7(5)9;2*7-6-4-2-1-3-5-6/h2-4,8-9H,1H3;2*1-5,7H.
What are the key properties of 2-methylbenzene-1,3-diol;phenol?
2-methylbenzene-1,3-diol;phenol has a molecular weight of 312.37 g/mol, XLogP of 4.19, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzene-1,3-diol;phenol is sourced from PubChem (CID 161016987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).