C9H20O4Si — CID 18962902
2-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropanoic acid (PubChem CID 18962902) has the molecular formula C9H20O4Si and a molecular weight of 220.34 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropanoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18962902 |
| Molecular Formula | C9H20O4Si |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropanoic acid |
| SMILES | CC(O)(O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C9H20O4Si/c1-8(2,3)14(5,6)13-9(4,12)7(10)11/h12H,1-6H3,(H,10,11) |
| InChIKey | YMFNNQMIMKHAJE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|