C14H28O4Si — CID 10758542
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3-methylhex-5-enoic acid (PubChem CID 10758542) has the molecular formula C14H28O4Si and a molecular weight of 288.46 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3-methylhex-5-enoic acid.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3-methylhex-5-enoic acid |
|---|---|
| PubChem CID | 10758542 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3-methylhex-5-enoic acid |
| SMILES | C=C(C[C@](C)(CC(=O)O)O[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C14H28O4Si/c1-11(17-6)9-14(5,10-12(15)16)18-19(7,8)13(2,3)4/h1,9-10H2,2-8H3,(H,15,16)/t14-/m1/s1 |
| InChIKey | NKFSWJDKZSNNRW-CQSZACIVSA-N |
| XLogP | 3.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|