C18H34O3Si — CID 134956328
3-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-1-en-3-yl]pentane-2,4-dione (PubChem CID 134956328) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is 3-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-1-en-3-yl]pentane-2,4-dione.
| Compound Name | 3-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-1-en-3-yl]pentane-2,4-dione |
|---|---|
| PubChem CID | 134956328 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 3-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-1-en-3-yl]pentane-2,4-dione |
| SMILES | C=C[C@@](C)(C(C(C)=O)C(C)=O)C(C)(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O3Si/c1-12-18(9,15(13(2)19)14(3)20)17(7,8)21-22(10,11)16(4,5)6/h12,15H,1H2,2-11H3/t18-/m0/s1 |
| InChIKey | LVAUJOOEWFHQSF-SFHVURJKSA-N |
| XLogP | 4.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|