C18H32O7Si — CID 11101162
(E)-7,7-diacetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-5-enoic acid (PubChem CID 11101162) has the molecular formula C18H32O7Si and a molecular weight of 388.53 g/mol. Its IUPAC name is (E)-7,7-diacetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-5-enoic acid.
| Compound Name | (E)-7,7-diacetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 11101162 |
| Molecular Formula | C18H32O7Si |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (E)-7,7-diacetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-5-enoic acid |
| SMILES | CC(=O)OC(/C=C/C(C)(CCC(=O)O)O[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C18H32O7Si/c1-13(19)23-16(24-14(2)20)10-12-18(6,11-9-15(21)22)25-26(7,8)17(3,4)5/h10,12,16H,9,11H2,1-8H3,(H,21,22)/b12-10+ |
| InChIKey | HSBBTBRHQZEQJM-ZRDIBKRKSA-N |
| XLogP | 3.64 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|