C12H25IOSi — CID 173222661
tert-butyl-(1-iodo-3-methylpent-1-en-3-yl)oxy-dimethylsilane (PubChem CID 173222661) has the molecular formula C12H25IOSi and a molecular weight of 340.32 g/mol. Its IUPAC name is tert-butyl-(1-iodo-3-methylpent-1-en-3-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(1-iodo-3-methylpent-1-en-3-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 173222661 |
| Molecular Formula | C12H25IOSi |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | tert-butyl-(1-iodo-3-methylpent-1-en-3-yl)oxy-dimethylsilane |
| SMILES | CCC(C)(C=CI)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H25IOSi/c1-8-12(5,9-10-13)14-15(6,7)11(2,3)4/h9-10H,8H2,1-7H3 |
| InChIKey | SQTNVDSEAULJRG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|