C16H39IO2Si2 — CID 174377351
tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;2-iodobutan-2-ol (PubChem CID 174377351) has the molecular formula C16H39IO2Si2 and a molecular weight of 446.56 g/mol. Its IUPAC name is tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;2-iodobutan-2-ol.
| Compound Name | tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;2-iodobutan-2-ol |
|---|---|
| PubChem CID | 174377351 |
| Molecular Formula | C16H39IO2Si2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;2-iodobutan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C.CCC(C)(O)I |
| InChI | InChI=1S/C12H30OSi2.C4H9IO/c1-11(2,3)14(7,8)13-15(9,10)12(4,5)6;1-3-4(2,5)6/h1-10H3;6H,3H2,1-2H3 |
| InChIKey | WHNZJJPHHZSNCO-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|