C18H39IO2Si2 — CID 88698590
tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;6-iodohexa-2,3-dien-1-ol (PubChem CID 88698590) has the molecular formula C18H39IO2Si2 and a molecular weight of 470.58 g/mol. Its IUPAC name is tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;6-iodohexa-2,3-dien-1-ol.
| Compound Name | tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;6-iodohexa-2,3-dien-1-ol |
|---|---|
| PubChem CID | 88698590 |
| Molecular Formula | C18H39IO2Si2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;6-iodohexa-2,3-dien-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C.OCC=C=CCCI |
| InChI | InChI=1S/C12H30OSi2.C6H9IO/c1-11(2,3)14(7,8)13-15(9,10)12(4,5)6;7-5-3-1-2-4-6-8/h1-10H3;1,4,8H,3,5-6H2 |
| InChIKey | YXJPAWRHKUOBBG-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|