C13H25ClOSi — CID 23253894
tert-butyl-(7-chlorohepta-3,4-dienoxy)-dimethylsilane (PubChem CID 23253894) has the molecular formula C13H25ClOSi and a molecular weight of 260.88 g/mol. Its IUPAC name is tert-butyl-(7-chlorohepta-3,4-dienoxy)-dimethylsilane.
| Compound Name | tert-butyl-(7-chlorohepta-3,4-dienoxy)-dimethylsilane |
|---|---|
| PubChem CID | 23253894 |
| Molecular Formula | C13H25ClOSi |
| Molecular Weight | 260.88 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | tert-butyl-(7-chlorohepta-3,4-dienoxy)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC=C=CCCCl |
| InChI | InChI=1S/C13H25ClOSi/c1-13(2,3)16(4,5)15-12-10-8-6-7-9-11-14/h7-8H,9-12H2,1-5H3 |
| InChIKey | MXXSFALKJUDDNR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.88 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|