C22H40OSi2 — CID 101405395
tert-butyl-[(3E,5E,7E)-10-[tert-butyl(dimethyl)silyl]deca-3,5,7-trien-9-ynoxy]-dimethylsilane (PubChem CID 101405395) has the molecular formula C22H40OSi2 and a molecular weight of 376.73 g/mol. Its IUPAC name is tert-butyl-[(3E,5E,7E)-10-[tert-butyl(dimethyl)silyl]deca-3,5,7-trien-9-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3E,5E,7E)-10-[tert-butyl(dimethyl)silyl]deca-3,5,7-trien-9-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101405395 |
| Molecular Formula | C22H40OSi2 |
| Molecular Weight | 376.73 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | tert-butyl-[(3E,5E,7E)-10-[tert-butyl(dimethyl)silyl]deca-3,5,7-trien-9-ynoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)C#C/C=C/C=C/C=C/CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40OSi2/c1-21(2,3)24(7,8)20-18-16-14-12-11-13-15-17-19-23-25(9,10)22(4,5)6/h11-16H,17,19H2,1-10H3/b12-11+,15-13+,16-14+ |
| InChIKey | UQCSWHIYXIGWCE-CAGMGGGLSA-N |
| XLogP | 7.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.73 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|