C13H26O2Si — CID 88697890
7-[tert-butyl(dimethyl)silyl]oxyhepta-2,3-dien-1-ol (PubChem CID 88697890) has the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxyhepta-2,3-dien-1-ol.
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxyhepta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 88697890 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxyhepta-2,3-dien-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC=C=CCO |
| InChI | InChI=1S/C13H26O2Si/c1-13(2,3)16(4,5)15-12-10-8-6-7-9-11-14/h6,9,14H,8,10-12H2,1-5H3 |
| InChIKey | WHOHXVXVIMIXGO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|