C14H26F2OSi — CID 162623288
tert-butyl-(8,8-difluoroocta-6,7-dienoxy)-dimethylsilane (PubChem CID 162623288) has the molecular formula C14H26F2OSi and a molecular weight of 276.44 g/mol. Its IUPAC name is tert-butyl-(8,8-difluoroocta-6,7-dienoxy)-dimethylsilane.
| Compound Name | tert-butyl-(8,8-difluoroocta-6,7-dienoxy)-dimethylsilane |
|---|---|
| PubChem CID | 162623288 |
| Molecular Formula | C14H26F2OSi |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | tert-butyl-(8,8-difluoroocta-6,7-dienoxy)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCC=C=C(F)F |
| InChI | InChI=1S/C14H26F2OSi/c1-14(2,3)18(4,5)17-12-10-8-6-7-9-11-13(15)16/h9H,6-8,10,12H2,1-5H3 |
| InChIKey | KDWMVCQIFQCIHJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|