C18H36OSi — CID 134976577
tert-butyl-(8-deuteriododeca-6,7-dienoxy)-dimethylsilane (PubChem CID 134976577) has the molecular formula C18H36OSi and a molecular weight of 297.58 g/mol. Its IUPAC name is tert-butyl-(8-deuteriododeca-6,7-dienoxy)-dimethylsilane.
| Compound Name | tert-butyl-(8-deuteriododeca-6,7-dienoxy)-dimethylsilane |
|---|---|
| PubChem CID | 134976577 |
| Molecular Formula | C18H36OSi |
| Molecular Weight | 297.58 g/mol |
| Exact Mass | 297.26 |
| IUPAC Name | tert-butyl-(8-deuteriododeca-6,7-dienoxy)-dimethylsilane |
| SMILES | [2H]C(=C=CCCCCCO[Si](C)(C)C(C)(C)C)CCCC |
| InChI | InChI=1S/C18H36OSi/c1-7-8-9-10-11-12-13-14-15-16-17-19-20(5,6)18(2,3)4/h10,12H,7-9,13-17H2,1-6H3/i10D |
| InChIKey | RPVOVHCDOFVAKS-MMIHMFRQSA-N |
| XLogP | 6.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.58 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|