C9H22O2Si — CID 71777166
3-[tert-butyl(dimethyl)silyl]oxy-1,1,2,2,3,3-hexadeuteriopropan-1-ol (PubChem CID 71777166) has the molecular formula C9H22O2Si and a molecular weight of 196.40 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-1,1,2,2,3,3-hexadeuteriopropan-1-ol.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-1,1,2,2,3,3-hexadeuteriopropan-1-ol |
|---|---|
| PubChem CID | 71777166 |
| Molecular Formula | C9H22O2Si |
| Molecular Weight | 196.40 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-1,1,2,2,3,3-hexadeuteriopropan-1-ol |
| SMILES | [2H]C([2H])(O)C([2H])([2H])C([2H])([2H])O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C9H22O2Si/c1-9(2,3)12(4,5)11-8-6-7-10/h10H,6-8H2,1-5H3/i6D2,7D2,8D2 |
| InChIKey | NETUFVYVNJNFMU-JEKPXRCASA-N |
| XLogP | 2.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|