C13H27IO2Si — CID 11199521
(E,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-iodo-3-methylhex-1-en-3-ol (PubChem CID 11199521) has the molecular formula C13H27IO2Si and a molecular weight of 370.35 g/mol. Its IUPAC name is (E,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-iodo-3-methylhex-1-en-3-ol.
| Compound Name | (E,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-iodo-3-methylhex-1-en-3-ol |
|---|---|
| PubChem CID | 11199521 |
| Molecular Formula | C13H27IO2Si |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | (E,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-iodo-3-methylhex-1-en-3-ol |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@](C)(O)/C=C/I |
| InChI | InChI=1S/C13H27IO2Si/c1-8-11(13(5,15)9-10-14)16-17(6,7)12(2,3)4/h9-11,15H,8H2,1-7H3/b10-9+/t11-,13+/m1/s1 |
| InChIKey | WSDWHGGDNSMGDQ-FCSPZMLESA-N |
| XLogP | 4.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|