C14H30O2Si — CID 46237117
(2S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhexanal (PubChem CID 46237117) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is (2S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhexanal.
| Compound Name | (2S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhexanal |
|---|---|
| PubChem CID | 46237117 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (2S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhexanal |
| SMILES | CC[C@H](C)C[C@@](C)(C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O2Si/c1-9-12(2)10-14(6,11-15)16-17(7,8)13(3,4)5/h11-12H,9-10H2,1-8H3/t12-,14-/m0/s1 |
| InChIKey | IYZZODFCDLPGPO-JSGCOSHPSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|