C18H42O2Si2 — CID 138965929
tert-butyl-dimethyl-(2-methyl-4-triethylsilyloxypentan-2-yl)oxysilane (PubChem CID 138965929) has the molecular formula C18H42O2Si2 and a molecular weight of 346.70 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2-methyl-4-triethylsilyloxypentan-2-yl)oxysilane.
| Compound Name | tert-butyl-dimethyl-(2-methyl-4-triethylsilyloxypentan-2-yl)oxysilane |
|---|---|
| PubChem CID | 138965929 |
| Molecular Formula | C18H42O2Si2 |
| Molecular Weight | 346.70 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | tert-butyl-dimethyl-(2-methyl-4-triethylsilyloxypentan-2-yl)oxysilane |
| SMILES | CC[Si](CC)(CC)OC(C)CC(C)(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H42O2Si2/c1-12-22(13-2,14-3)19-16(4)15-18(8,9)20-21(10,11)17(5,6)7/h16H,12-15H2,1-11H3 |
| InChIKey | FIOYUUALIOYIRJ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.70 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|