C18H37NO2Si2 — CID 102246695
(Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-ethylbut-3-enenitrile (PubChem CID 102246695) has the molecular formula C18H37NO2Si2 and a molecular weight of 355.67 g/mol. Its IUPAC name is (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-ethylbut-3-enenitrile.
| Compound Name | (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-ethylbut-3-enenitrile |
|---|---|
| PubChem CID | 102246695 |
| Molecular Formula | C18H37NO2Si2 |
| Molecular Weight | 355.67 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-ethylbut-3-enenitrile |
| SMILES | CC[C@](C#N)(/C=C\O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H37NO2Si2/c1-12-18(15-19,21-23(10,11)17(5,6)7)13-14-20-22(8,9)16(2,3)4/h13-14H,12H2,1-11H3/b14-13-/t18-/m1/s1 |
| InChIKey | GYDLOEVQQCJSBQ-SWNWVQGVSA-N |
| XLogP | 6.22 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|